C22H32N4O4 — CID 45488435
2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butyl-4-methylpentanamide (PubChem CID 45488435) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butyl-4-methylpentanamide.
| Compound Name | 2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butyl-4-methylpentanamide |
|---|---|
| PubChem CID | 45488435 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butyl-4-methylpentanamide |
| SMILES | CCCCNC(=O)C(CC(C)C)N1C(=O)c2cc(NC(C)=O)ccc2NC(=O)[C@@H]1C |
| InChI | InChI=1S/C22H32N4O4/c1-6-7-10-23-21(29)19(11-13(2)3)26-14(4)20(28)25-18-9-8-16(24-15(5)27)12-17(18)22(26)30/h8-9,12-14,19H,6-7,10-11H2,1-5H3,(H,23,29)(H,24,27)(H,25,28)/t14-,19?/m0/s1 |
| InChIKey | HDPHPPBHGKAPBY-KTQQKIMGSA-N |
| XLogP | 2.76 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|