C27H28N2O2 — CID 45488440
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-phenylacetate (PubChem CID 45488440) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-phenylacetate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-phenylacetate |
|---|---|
| PubChem CID | 45488440 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-phenylacetate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OC(=O)Cc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H28N2O2/c1-2-20-18-29-15-13-21(20)17-25(29)27(31-26(30)16-19-8-4-3-5-9-19)23-12-14-28-24-11-7-6-10-22(23)24/h2-12,14,20-21,25,27H,1,13,15-18H2/t20-,21-,25+,27-/m0/s1 |
| InChIKey | CXWAPTLRKBDJQG-YABFEGCQSA-N |
| XLogP | 4.96 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|