About ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide
ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide (PubChem CID 45488444) has the molecular formula C21H33IN2O2
and a molecular weight of 472.41 g/mol. Its IUPAC name is ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide.
Molecular Properties
| Compound Name | ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide |
| PubChem CID | 45488444 |
| Molecular Formula | C21H33IN2O2 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide |
| SMILES | CCCCCCCC[n+]1c(C)n(CC)c2cc(C(=O)OCC)ccc21.[I-] |
| InChI | InChI=1S/C21H33N2O2.HI/c1-5-8-9-10-11-12-15-23-17(4)22(6-2)20-16-18(13-14-19(20)23)21(24)25-7-3;/h13-14,16H,5-12,15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MQYHWGUIQJDWIE-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide?
The IUPAC name of ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide (CID 45488444) is ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide.
What is the SMILES notation for ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide?
The canonical SMILES for ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide is CCCCCCCC[n+]1c(C)n(CC)c2cc(C(=O)OCC)ccc21.[I-].
What is the InChIKey of ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide?
The InChIKey is MQYHWGUIQJDWIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H33N2O2.HI/c1-5-8-9-10-11-12-15-23-17(4)22(6-2)20-16-18(13-14-19(20)23)21(24)25-7-3;/h13-14,16H,5-12,15H2,1-4H3;1H/q+1;/p-1.
What are the key properties of ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide?
ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide has a molecular weight of 472.41 g/mol, XLogP of 1.80, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethyl-2-methyl-1-octylbenzimidazol-1-ium-5-carboxylate iodide is sourced from PubChem (CID 45488444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).