C27H25N5O5S — CID 45488540
N-[4-(1-methyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dinitrobenzamide (PubChem CID 45488540) has the molecular formula C27H25N5O5S and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[4-(1-methyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(1-methyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 45488540 |
| Molecular Formula | C27H25N5O5S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[4-(1-methyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dinitrobenzamide |
| SMILES | Cn1c(SCCCCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H25N5O5S/c1-30-25(20-12-6-3-7-13-20)24(19-10-4-2-5-11-19)29-27(30)38-15-9-8-14-28-26(33)21-16-22(31(34)35)18-23(17-21)32(36)37/h2-7,10-13,16-18H,8-9,14-15H2,1H3,(H,28,33) |
| InChIKey | NNDUNYYSKZEBPM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|