About 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea
1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea (PubChem CID 45488562) has the molecular formula C23H28N4OS
and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea |
| PubChem CID | 45488562 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea |
| SMILES | CCCn1c(SCCNC(=O)NCC)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H28N4OS/c1-3-16-27-21(19-13-9-6-10-14-19)20(18-11-7-5-8-12-18)26-23(27)29-17-15-25-22(28)24-4-2/h5-14H,3-4,15-17H2,1-2H3,(H2,24,25,28) |
| InChIKey | FSLKJLRWYMKARO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea?
The IUPAC name of 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea (CID 45488562) is 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea.
What is the SMILES notation for 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea?
The canonical SMILES for 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea is CCCn1c(SCCNC(=O)NCC)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea?
The InChIKey is FSLKJLRWYMKARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4OS/c1-3-16-27-21(19-13-9-6-10-14-19)20(18-11-7-5-8-12-18)26-23(27)29-17-15-25-22(28)24-4-2/h5-14H,3-4,15-17H2,1-2H3,(H2,24,25,28).
What are the key properties of 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea?
1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea has a molecular weight of 408.57 g/mol, XLogP of 5.04, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-3-ethylurea is sourced from PubChem (CID 45488562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).