C26H26F3N3O6 — CID 45488589
benzyl N-[2-[[2-[phenyl(pyridin-3-yl)methoxy]acetyl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 45488589) has the molecular formula C26H26F3N3O6 and a molecular weight of 533.50 g/mol. Its IUPAC name is benzyl N-[2-[[2-[phenyl(pyridin-3-yl)methoxy]acetyl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl N-[2-[[2-[phenyl(pyridin-3-yl)methoxy]acetyl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45488589 |
| Molecular Formula | C26H26F3N3O6 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | benzyl N-[2-[[2-[phenyl(pyridin-3-yl)methoxy]acetyl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(COC(c1ccccc1)c1cccnc1)NCCNC(=O)OCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H25N3O4.C2HF3O2/c28-22(26-14-15-27-24(29)31-17-19-8-3-1-4-9-19)18-30-23(20-10-5-2-6-11-20)21-12-7-13-25-16-21;3-2(4,5)1(6)7/h1-13,16,23H,14-15,17-18H2,(H,26,28)(H,27,29);(H,6,7) |
| InChIKey | RFCXBKOFEXZNOS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|