C25H38N6O — CID 45488618
N-benzyl-2-[3-(2-methylpiperidin-1-yl)propylamino]-4-(2-methylpropylamino)pyrimidine-5-carboxamide (PubChem CID 45488618) has the molecular formula C25H38N6O and a molecular weight of 438.62 g/mol. Its IUPAC name is N-benzyl-2-[3-(2-methylpiperidin-1-yl)propylamino]-4-(2-methylpropylamino)pyrimidine-5-carboxamide.
| Compound Name | N-benzyl-2-[3-(2-methylpiperidin-1-yl)propylamino]-4-(2-methylpropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 45488618 |
| Molecular Formula | C25H38N6O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | N-benzyl-2-[3-(2-methylpiperidin-1-yl)propylamino]-4-(2-methylpropylamino)pyrimidine-5-carboxamide |
| SMILES | CC(C)CNc1nc(NCCCN2CCCCC2C)ncc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H38N6O/c1-19(2)16-27-23-22(24(32)28-17-21-11-5-4-6-12-21)18-29-25(30-23)26-13-9-15-31-14-8-7-10-20(31)3/h4-6,11-12,18-20H,7-10,13-17H2,1-3H3,(H,28,32)(H2,26,27,29,30) |
| InChIKey | KTCWYDMMEIBDJO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|