C25H25ClF6N2O8 — CID 45488622
methyl 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 45488622) has the molecular formula C25H25ClF6N2O8 and a molecular weight of 630.92 g/mol. Its IUPAC name is methyl 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | methyl 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 45488622 |
| Molecular Formula | C25H25ClF6N2O8 |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | methyl 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COC(=O)C1CCN(C(=O)COC(c2ccccc2)c2cccnc2Cl)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23ClN2O4.2C2HF3O2/c1-27-21(26)16-9-12-24(13-10-16)18(25)14-28-19(15-6-3-2-4-7-15)17-8-5-11-23-20(17)22;2*3-2(4,5)1(6)7/h2-8,11,16,19H,9-10,12-14H2,1H3;2*(H,6,7) |
| InChIKey | LKPFTDYHWDLOIL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|