C20H23ClN6O — CID 45488654
3-(4-chlorophenyl)-N-[2-(diethylamino)ethyl]-5-(tetrazol-1-yl)benzamide (PubChem CID 45488654) has the molecular formula C20H23ClN6O and a molecular weight of 398.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(diethylamino)ethyl]-5-(tetrazol-1-yl)benzamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(diethylamino)ethyl]-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 45488654 |
| Molecular Formula | C20H23ClN6O |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(diethylamino)ethyl]-5-(tetrazol-1-yl)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(-c2ccc(Cl)cc2)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C20H23ClN6O/c1-3-26(4-2)10-9-22-20(28)17-11-16(15-5-7-18(21)8-6-15)12-19(13-17)27-14-23-24-25-27/h5-8,11-14H,3-4,9-10H2,1-2H3,(H,22,28) |
| InChIKey | DZNCSVFAMFGOLI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |