C14H16F3N3O4 — CID 45488659
4-piperidin-4-yloxy-1,2-benzoxazol-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 45488659) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45488659 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1noc2cccc(OC3CCNCC3)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H15N3O2.C2HF3O2/c13-12-11-9(2-1-3-10(11)17-15-12)16-8-4-6-14-7-5-8;3-2(4,5)1(6)7/h1-3,8,14H,4-7H2,(H2,13,15);(H,6,7) |
| InChIKey | BBENXGVLPBYVTF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |