About 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine
4-piperidin-4-yloxy-1,2-benzoxazol-3-amine (PubChem CID 45488660) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine |
| PubChem CID | 45488660 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2cccc(OC3CCNCC3)c12 |
| InChI | InChI=1S/C12H15N3O2/c13-12-11-9(2-1-3-10(11)17-15-12)16-8-4-6-14-7-5-8/h1-3,8,14H,4-7H2,(H2,13,15) |
| InChIKey | FHUMMAZWRZJFER-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine?
The IUPAC name of 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine (CID 45488660) is 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine.
What is the SMILES notation for 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine?
The canonical SMILES for 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine is Nc1noc2cccc(OC3CCNCC3)c12.
What is the InChIKey of 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine?
The InChIKey is FHUMMAZWRZJFER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c13-12-11-9(2-1-3-10(11)17-15-12)16-8-4-6-14-7-5-8/h1-3,8,14H,4-7H2,(H2,13,15).
What are the key properties of 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine?
4-piperidin-4-yloxy-1,2-benzoxazol-3-amine has a molecular weight of 233.27 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-yloxy-1,2-benzoxazol-3-amine is sourced from PubChem (CID 45488660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).