About 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine
3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 45488666) has the molecular formula C23H19N5
and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 45488666 |
| Molecular Formula | C23H19N5 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | c1cncc(CCNc2nccn3c(-c4ccc5ccccc5c4)cnc23)c1 |
| InChI | InChI=1S/C23H19N5/c1-2-6-19-14-20(8-7-18(19)5-1)21-16-27-23-22(26-12-13-28(21)23)25-11-9-17-4-3-10-24-15-17/h1-8,10,12-16H,9,11H2,(H,25,26) |
| InChIKey | MQLGNLCCWJSVEO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine (CID 45488666) is 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine is c1cncc(CCNc2nccn3c(-c4ccc5ccccc5c4)cnc23)c1.
What is the InChIKey of 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is MQLGNLCCWJSVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5/c1-2-6-19-14-20(8-7-18(19)5-1)21-16-27-23-22(26-12-13-28(21)23)25-11-9-17-4-3-10-24-15-17/h1-8,10,12-16H,9,11H2,(H,25,26).
What are the key properties of 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine?
3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 365.44 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-yl-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 45488666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).