About (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride
(E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride (PubChem CID 45488710) has the molecular formula C16H17ClN2O3
and a molecular weight of 320.78 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride |
| PubChem CID | 45488710 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccncc2)cc1OC.Cl |
| InChI | InChI=1S/C16H16N2O3.ClH/c1-20-14-5-3-12(11-15(14)21-2)4-6-16(19)18-13-7-9-17-10-8-13;/h3-11H,1-2H3,(H,17,18,19);1H/b6-4+; |
| InChIKey | QEVQIWIATKYFNK-CVDVRWGVSA-N |
| XLogP | 3.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride?
The IUPAC name of (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride (CID 45488710) is (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride.
What is the SMILES notation for (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride?
The canonical SMILES for (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride is COc1ccc(/C=C/C(=O)Nc2ccncc2)cc1OC.Cl.
What is the InChIKey of (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride?
The InChIKey is QEVQIWIATKYFNK-CVDVRWGVSA-N. The full InChI is InChI=1S/C16H16N2O3.ClH/c1-20-14-5-3-12(11-15(14)21-2)4-6-16(19)18-13-7-9-17-10-8-13;/h3-11H,1-2H3,(H,17,18,19);1H/b6-4+;.
What are the key properties of (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride?
(E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride has a molecular weight of 320.78 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4-dimethoxyphenyl)-N-pyridin-4-ylprop-2-enamide;hydrochloride is sourced from PubChem (CID 45488710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).