About N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline
N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline (PubChem CID 45488776) has the molecular formula C26H25N2S+
and a molecular weight of 397.57 g/mol. Its IUPAC name is N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline.
Molecular Properties
| Compound Name | N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline |
| PubChem CID | 45488776 |
| Molecular Formula | C26H25N2S+ |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline |
| SMILES | CC[n+]1c(/C=C/N(C)c2ccccc2)sc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H25N2S/c1-3-28-24(19-20-27(2)23-17-11-6-12-18-23)29-26(22-15-9-5-10-16-22)25(28)21-13-7-4-8-14-21/h4-20H,3H2,1-2H3/q+1 |
| InChIKey | CXXCZEAHAXQOTH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline?
The IUPAC name of N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline (CID 45488776) is N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline.
What is the SMILES notation for N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline?
The canonical SMILES for N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline is CC[n+]1c(/C=C/N(C)c2ccccc2)sc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline?
The InChIKey is CXXCZEAHAXQOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N2S/c1-3-28-24(19-20-27(2)23-17-11-6-12-18-23)29-26(22-15-9-5-10-16-22)25(28)21-13-7-4-8-14-21/h4-20H,3H2,1-2H3/q+1.
What are the key properties of N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline?
N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline has a molecular weight of 397.57 g/mol, XLogP of 6.50, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)ethenyl]-N-methylaniline is sourced from PubChem (CID 45488776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).