About 9-butoxyacridine
9-butoxyacridine (PubChem CID 45488807) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 9-butoxyacridine.
Molecular Properties
| Compound Name | 9-butoxyacridine |
| PubChem CID | 45488807 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 9-butoxyacridine |
| SMILES | CCCCOc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C17H17NO/c1-2-3-12-19-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17/h4-11H,2-3,12H2,1H3 |
| InChIKey | SALFAEOTMZLWHI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-butoxyacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butoxyacridine?
The IUPAC name of 9-butoxyacridine (CID 45488807) is 9-butoxyacridine.
What is the SMILES notation for 9-butoxyacridine?
The canonical SMILES for 9-butoxyacridine is CCCCOc1c2ccccc2nc2ccccc12.
What is the InChIKey of 9-butoxyacridine?
The InChIKey is SALFAEOTMZLWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO/c1-2-3-12-19-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17/h4-11H,2-3,12H2,1H3.
What are the key properties of 9-butoxyacridine?
9-butoxyacridine has a molecular weight of 251.33 g/mol, XLogP of 4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butoxyacridine is sourced from PubChem (CID 45488807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).