C23H25F3N6O3 — CID 45488810
N-(3-morpholin-4-ylpropyl)-2,6-dipyridin-2-ylpyrimidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 45488810) has the molecular formula C23H25F3N6O3 and a molecular weight of 490.49 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2,6-dipyridin-2-ylpyrimidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2,6-dipyridin-2-ylpyrimidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45488810 |
| Molecular Formula | C23H25F3N6O3 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2,6-dipyridin-2-ylpyrimidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(-c2cc(NCCCN3CCOCC3)nc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C21H24N6O.C2HF3O2/c1-3-8-22-17(6-1)19-16-20(24-10-5-11-27-12-14-28-15-13-27)26-21(25-19)18-7-2-4-9-23-18;3-2(4,5)1(6)7/h1-4,6-9,16H,5,10-15H2,(H,24,25,26);(H,6,7) |
| InChIKey | FQLSEARJCITXJN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|