C33H42N4O3S — CID 45488838
N-[[4-(dimethylamino)phenyl]methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 45488838) has the molecular formula C33H42N4O3S and a molecular weight of 574.79 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 45488838 |
| Molecular Formula | C33H42N4O3S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(NC(C)CCCN(Cc2ccc(N(C)C)cc2)S(=O)(=O)c2c(C)cc(C)cc2C)c2ncccc2c1 |
| InChI | InChI=1S/C33H42N4O3S/c1-23-18-24(2)33(25(3)19-23)41(38,39)37(22-27-12-14-29(15-13-27)36(5)6)17-9-10-26(4)35-31-21-30(40-7)20-28-11-8-16-34-32(28)31/h8,11-16,18-21,26,35H,9-10,17,22H2,1-7H3 |
| InChIKey | JHIGEDCSTBQHSH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|