C21H28N4O4 — CID 45488889
(E)-2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butylpent-3-enamide (PubChem CID 45488889) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is (E)-2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butylpent-3-enamide.
| Compound Name | (E)-2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butylpent-3-enamide |
|---|---|
| PubChem CID | 45488889 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (E)-2-[(3S)-7-acetamido-3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl]-N-butylpent-3-enamide |
| SMILES | C/C=C/C(C(=O)NCCCC)N1C(=O)c2cc(NC(C)=O)ccc2NC(=O)[C@@H]1C |
| InChI | InChI=1S/C21H28N4O4/c1-5-7-11-22-20(28)18(8-6-2)25-13(3)19(27)24-17-10-9-15(23-14(4)26)12-16(17)21(25)29/h6,8-10,12-13,18H,5,7,11H2,1-4H3,(H,22,28)(H,23,26)(H,24,27)/b8-6+/t13-,18?/m0/s1 |
| InChIKey | TZYPTUPDVTXHCG-DIZDJHTDSA-N |
| XLogP | 2.29 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|