About N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride
N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride (PubChem CID 45488952) has the molecular formula C19H28ClN3O
and a molecular weight of 349.91 g/mol. Its IUPAC name is N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride |
| PubChem CID | 45488952 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=c1\ccn(CC(=O)N(CCCC)CCCC)c2ccccc12 |
| InChI | InChI=1S/C19H27N3O.ClH/c1-3-5-12-21(13-6-4-2)19(23)15-22-14-11-17(20)16-9-7-8-10-18(16)22;/h7-11,14,20H,3-6,12-13,15H2,1-2H3;1H/b20-17+; |
| InChIKey | INZXEVOOFFRIDF-SJEOTZHBSA-N |
| XLogP | 3.97 |
| TPSA | 49.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride?
The IUPAC name of N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride (CID 45488952) is N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride.
What is the SMILES notation for N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride?
The canonical SMILES for N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride is Cl.[H]/N=c1\ccn(CC(=O)N(CCCC)CCCC)c2ccccc12.
What is the InChIKey of N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride?
The InChIKey is INZXEVOOFFRIDF-SJEOTZHBSA-N. The full InChI is InChI=1S/C19H27N3O.ClH/c1-3-5-12-21(13-6-4-2)19(23)15-22-14-11-17(20)16-9-7-8-10-18(16)22;/h7-11,14,20H,3-6,12-13,15H2,1-2H3;1H/b20-17+;.
What are the key properties of N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride?
N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride has a molecular weight of 349.91 g/mol, XLogP of 3.97, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-2-(4-iminoquinolin-1-yl)acetamide;hydrochloride is sourced from PubChem (CID 45488952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).