About ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride
ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride (PubChem CID 45488953) has the molecular formula C20H24ClNO5
and a molecular weight of 393.87 g/mol. Its IUPAC name is ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride |
| PubChem CID | 45488953 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c[nH]c2cc(OCC3CC3)c(OCC3CC3)cc2c1=O.Cl |
| InChI | InChI=1S/C20H23NO5.ClH/c1-2-24-20(23)15-9-21-16-8-18(26-11-13-5-6-13)17(7-14(16)19(15)22)25-10-12-3-4-12;/h7-9,12-13H,2-6,10-11H2,1H3,(H,21,22);1H |
| InChIKey | RHNVFRUNONKBGD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride?
The IUPAC name of ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride (CID 45488953) is ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride?
The canonical SMILES for ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride is CCOC(=O)c1c[nH]c2cc(OCC3CC3)c(OCC3CC3)cc2c1=O.Cl.
What is the InChIKey of ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride?
The InChIKey is RHNVFRUNONKBGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO5.ClH/c1-2-24-20(23)15-9-21-16-8-18(26-11-13-5-6-13)17(7-14(16)19(15)22)25-10-12-3-4-12;/h7-9,12-13H,2-6,10-11H2,1H3,(H,21,22);1H.
What are the key properties of ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride?
ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride has a molecular weight of 393.87 g/mol, XLogP of 3.70, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6,7-bis(cyclopropylmethoxy)-4-oxo-1H-quinoline-3-carboxylate;hydrochloride is sourced from PubChem (CID 45488953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).