C31H37N3O4 — CID 45489063
[2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dimethoxybenzoate (PubChem CID 45489063) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 45489063 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2-c2nc3cc(C)ccn3c2NC(C)(C)CC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C31H37N3O4/c1-20-15-16-34-26(17-20)32-27(28(34)33-31(5,6)19-30(2,3)4)22-11-9-10-12-24(22)38-29(35)23-14-13-21(36-7)18-25(23)37-8/h9-18,33H,19H2,1-8H3 |
| InChIKey | VHEULEHIEIGLJQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|