C24H24ClF6N3O7 — CID 45489126
1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 45489126) has the molecular formula C24H24ClF6N3O7 and a molecular weight of 615.91 g/mol. Its IUPAC name is 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 45489126 |
| Molecular Formula | C24H24ClF6N3O7 |
| Molecular Weight | 615.91 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | 1-[2-[(2-chloro-3-pyridinyl)-phenylmethoxy]acetyl]piperidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(=O)C1CCCN(C(=O)COC(c2ccccc2)c2cccnc2Cl)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22ClN3O3.2C2HF3O2/c21-19-16(9-4-10-23-19)18(14-6-2-1-3-7-14)27-13-17(25)24-11-5-8-15(12-24)20(22)26;2*3-2(4,5)1(6)7/h1-4,6-7,9-10,15,18H,5,8,11-13H2,(H2,22,26);2*(H,6,7) |
| InChIKey | NXSJMWFVZBQBRO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 160.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|