C22H17Cl3N2O — CID 45489180
2-[2,4-bis(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol (PubChem CID 45489180) has the molecular formula C22H17Cl3N2O and a molecular weight of 431.75 g/mol. Its IUPAC name is 2-[2,4-bis(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol.
| Compound Name | 2-[2,4-bis(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 45489180 |
| Molecular Formula | C22H17Cl3N2O |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-[2,4-bis(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
| SMILES | Oc1ccc(Cl)cc1C1CC(c2ccc(Cl)cc2)=NC(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C22H17Cl3N2O/c23-15-5-1-13(2-6-15)19-12-20(18-11-17(25)9-10-21(18)28)27-22(26-19)14-3-7-16(24)8-4-14/h1-11,20,22,27-28H,12H2 |
| InChIKey | XKLPSSJPCWPKBB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|