About methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate
methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate (PubChem CID 45489228) has the molecular formula C23H23N3O4S
and a molecular weight of 437.52 g/mol. Its IUPAC name is methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate |
| PubChem CID | 45489228 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC3(CC2)Nc2ccccc2-n2cccc23)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-30-22(27)17-8-10-18(11-9-17)31(28,29)25-15-12-23(13-16-25)21-7-4-14-26(21)20-6-3-2-5-19(20)24-23/h2-11,14,24H,12-13,15-16H2,1H3 |
| InChIKey | CONLISTUDAUAKK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate?
The IUPAC name of methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate (CID 45489228) is methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate.
What is the SMILES notation for methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate?
The canonical SMILES for methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate is COC(=O)c1ccc(S(=O)(=O)N2CCC3(CC2)Nc2ccccc2-n2cccc23)cc1.
What is the InChIKey of methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate?
The InChIKey is CONLISTUDAUAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O4S/c1-30-22(27)17-8-10-18(11-9-17)31(28,29)25-15-12-23(13-16-25)21-7-4-14-26(21)20-6-3-2-5-19(20)24-23/h2-11,14,24H,12-13,15-16H2,1H3.
What are the key properties of methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate?
methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate has a molecular weight of 437.52 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylsulfonylbenzoate is sourced from PubChem (CID 45489228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).