About 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride
1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride (PubChem CID 45489305) has the molecular formula C32H33ClN2O
and a molecular weight of 497.08 g/mol. Its IUPAC name is 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride |
| PubChem CID | 45489305 |
| Molecular Formula | C32H33ClN2O |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1ccc2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2CC(O)CNCCc1ccccc1.Cl |
| InChI | InChI=1S/C32H32N2O.ClH/c1-24-17-18-30-29(21-24)31(26-13-7-3-8-14-26)32(27-15-9-4-10-16-27)34(30)23-28(35)22-33-20-19-25-11-5-2-6-12-25;/h2-18,21,28,33,35H,19-20,22-23H2,1H3;1H |
| InChIKey | ZXRDCZXTVFSUGJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride?
The IUPAC name of 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride (CID 45489305) is 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride.
What is the SMILES notation for 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride?
The canonical SMILES for 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride is Cc1ccc2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2CC(O)CNCCc1ccccc1.Cl.
What is the InChIKey of 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride?
The InChIKey is ZXRDCZXTVFSUGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32N2O.ClH/c1-24-17-18-30-29(21-24)31(26-13-7-3-8-14-26)32(27-15-9-4-10-16-27)34(30)23-28(35)22-33-20-19-25-11-5-2-6-12-25;/h2-18,21,28,33,35H,19-20,22-23H2,1H3;1H.
What are the key properties of 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride?
1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride has a molecular weight of 497.08 g/mol, XLogP of 6.90, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-2,3-diphenylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol;hydrochloride is sourced from PubChem (CID 45489305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).