C6H10O6 — CID 45490001
(2R,3R,4S)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-3,4,5,6-tetrol (PubChem CID 45490001) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (2R,3R,4S)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-3,4,5,6-tetrol.
| Compound Name | (2R,3R,4S)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 45490001 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (2R,3R,4S)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-3,4,5,6-tetrol |
| SMILES | OC[C@H]1OC(O)=C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-4,7-11H,1H2/t2-,3+,4+/m1/s1 |
| InChIKey | ZMAKHBFMBBEKBJ-UZBSEBFBSA-N |
| XLogP | -1.62 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |