About diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate
diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate (PubChem CID 45490268) has the molecular formula C24H26N2O4
and a molecular weight of 406.48 g/mol. Its IUPAC name is diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate.
Molecular Properties
| Compound Name | diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate |
| PubChem CID | 45490268 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate |
| SMILES | CCOC(=O)/C=C(/Nc1cc2c(cc1C)cc(-c1ccccc1)n2C)C(=O)OCC |
| InChI | InChI=1S/C24H26N2O4/c1-5-29-23(27)15-20(24(28)30-6-2)25-19-14-22-18(12-16(19)3)13-21(26(22)4)17-10-8-7-9-11-17/h7-15,25H,5-6H2,1-4H3/b20-15+ |
| InChIKey | CINGARQMOIASGC-HMMYKYKNSA-N |
| XLogP | 4.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate?
The IUPAC name of diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate (CID 45490268) is diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate.
What is the SMILES notation for diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate?
The canonical SMILES for diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate is CCOC(=O)/C=C(/Nc1cc2c(cc1C)cc(-c1ccccc1)n2C)C(=O)OCC.
What is the InChIKey of diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate?
The InChIKey is CINGARQMOIASGC-HMMYKYKNSA-N. The full InChI is InChI=1S/C24H26N2O4/c1-5-29-23(27)15-20(24(28)30-6-2)25-19-14-22-18(12-16(19)3)13-21(26(22)4)17-10-8-7-9-11-17/h7-15,25H,5-6H2,1-4H3/b20-15+.
What are the key properties of diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate?
diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate has a molecular weight of 406.48 g/mol, XLogP of 4.58, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (E)-2-[(1,5-dimethyl-2-phenylindol-6-yl)amino]but-2-enedioate is sourced from PubChem (CID 45490268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).