C19H14FN5O — CID 45490368
2,4,8-triamino-5-(4-fluorophenyl)-5H-chromeno[2,3-b]pyridine-3-carbonitrile (PubChem CID 45490368) has the molecular formula C19H14FN5O and a molecular weight of 347.35 g/mol. Its IUPAC name is 2,4,8-triamino-5-(4-fluorophenyl)-5H-chromeno[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 2,4,8-triamino-5-(4-fluorophenyl)-5H-chromeno[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 45490368 |
| Molecular Formula | C19H14FN5O |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2,4,8-triamino-5-(4-fluorophenyl)-5H-chromeno[2,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1N)C(c1ccc(F)cc1)c1ccc(N)cc1O2 |
| InChI | InChI=1S/C19H14FN5O/c20-10-3-1-9(2-4-10)15-12-6-5-11(22)7-14(12)26-19-16(15)17(23)13(8-21)18(24)25-19/h1-7,15H,22H2,(H4,23,24,25) |
| InChIKey | SLJJXBMBXHJBKK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|