C29H34N4O3 — CID 45490594
5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile (PubChem CID 45490594) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 45490594 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(/C=C/c2nc(C#N)c(N3CCCC4=C[C@H]5C[C@H](CN6CCCC[C@H]56)[C@@H]43)o2)cc1OC |
| InChI | InChI=1S/C29H34N4O3/c1-34-25-10-8-19(14-26(25)35-2)9-11-27-31-23(17-30)29(36-27)33-13-5-6-20-15-21-16-22(28(20)33)18-32-12-4-3-7-24(21)32/h8-11,14-15,21-22,24,28H,3-7,12-13,16,18H2,1-2H3/b11-9+/t21-,22+,24+,28+/m0/s1 |
| InChIKey | XTQFSJDYAOBCLM-LSCOQLALSA-N |
| XLogP | 5.13 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|