C20H14O5 — CID 45490658
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)furo[3,2-g]chromen-7-one (PubChem CID 45490658) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)furo[3,2-g]chromen-7-one.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 45490658 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)furo[3,2-g]chromen-7-one |
| SMILES | O=c1ccc2cc3c(-c4ccc5c(c4)OCCCO5)coc3cc2o1 |
| InChI | InChI=1S/C20H14O5/c21-20-5-3-13-8-14-15(11-24-18(14)10-17(13)25-20)12-2-4-16-19(9-12)23-7-1-6-22-16/h2-5,8-11H,1,6-7H2 |
| InChIKey | ZNNMJOAWDAQPGR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|