C16H19N3O4S2 — CID 4549129
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 4549129) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4549129 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)Nc3nccs3)cc2)CC(C)O1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-11-9-19(10-12(2)23-11)25(21,22)14-5-3-13(4-6-14)15(20)18-16-17-7-8-24-16/h3-8,11-12H,9-10H2,1-2H3,(H,17,18,20) |
| InChIKey | PBJPDUBWLXOFHR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |