About 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one
2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one (PubChem CID 45491411) has the molecular formula C12H10N2O
and a molecular weight of 198.23 g/mol. Its IUPAC name is 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one.
Molecular Properties
| Compound Name | 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one |
| PubChem CID | 45491411 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one |
| SMILES | O=C1CCC2=C1C=Nc1ccccc1N2 |
| InChI | InChI=1S/C12H10N2O/c15-12-6-5-9-8(12)7-13-10-3-1-2-4-11(10)14-9/h1-4,7,14H,5-6H2 |
| InChIKey | SJUHIPHPKLPYCP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one?
The IUPAC name of 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one (CID 45491411) is 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one.
What is the SMILES notation for 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one?
The canonical SMILES for 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one is O=C1CCC2=C1C=Nc1ccccc1N2.
What is the InChIKey of 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one?
The InChIKey is SJUHIPHPKLPYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c15-12-6-5-9-8(12)7-13-10-3-1-2-4-11(10)14-9/h1-4,7,14H,5-6H2.
What are the key properties of 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one?
2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one has a molecular weight of 198.23 g/mol, XLogP of 2.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-dihydro-1H-cyclopenta[b][1,5]benzodiazepin-3-one is sourced from PubChem (CID 45491411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).