C20H24ClN3O4 — CID 45491834
2-[1-(carboxymethyl)-6-chloroindol-3-yl]-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid (PubChem CID 45491834) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-6-chloroindol-3-yl]-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[1-(carboxymethyl)-6-chloroindol-3-yl]-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 45491834 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[1-(carboxymethyl)-6-chloroindol-3-yl]-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid |
| SMILES | C=C(C)CN1CCN(C(C(=O)O)c2cn(CC(=O)O)c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C20H24ClN3O4/c1-13(2)10-22-5-7-23(8-6-22)19(20(27)28)16-11-24(12-18(25)26)17-9-14(21)3-4-15(16)17/h3-4,9,11,19H,1,5-8,10,12H2,2H3,(H,25,26)(H,27,28) |
| InChIKey | QDPWZACGDYUIOP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|