C11H16ClN5S — CID 4549296
3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4549296) has the molecular formula C11H16ClN5S and a molecular weight of 285.80 g/mol. Its IUPAC name is 3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4549296 |
| Molecular Formula | C11H16ClN5S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(C)c(-c2n[nH]c(=S)n2CC(C)C)c1Cl |
| InChI | InChI=1S/C11H16ClN5S/c1-6(2)5-17-10(13-14-11(17)18)9-8(12)7(3)15-16(9)4/h6H,5H2,1-4H3,(H,14,18) |
| InChIKey | PNKXWRZQKRNFBM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|