C14H15ClFN5O — CID 45494171
N-(3-chloro-4-fluorophenyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide (PubChem CID 45494171) has the molecular formula C14H15ClFN5O and a molecular weight of 323.76 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 45494171 |
| Molecular Formula | C14H15ClFN5O |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-(tetrazol-1-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C1(n2cnnn2)CCCCC1 |
| InChI | InChI=1S/C14H15ClFN5O/c15-11-8-10(4-5-12(11)16)18-13(22)14(6-2-1-3-7-14)21-9-17-19-20-21/h4-5,8-9H,1-3,6-7H2,(H,18,22) |
| InChIKey | VOJGQGIMEGMHHD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |