6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid

C12H7F2NO3 — CID 45496333

IUPAC6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(-c2ccc(F)cc2F)[nH]c1=O
InChIInChI=1S/C12H7F2NO3/c13-6-1-2-7(9(14)5-6)10-4-3-8(12(17)18)11(16)15-10/h1-5H,(H,15,16)(H,17,18)
InChIKeyYZZSXQYEQFSNHH-UHFFFAOYSA-N
MW251.19 g/mol
LogP2.02
Rot. Bonds2

About 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid

6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 45496333) has the molecular formula C12H7F2NO3 and a molecular weight of 251.19 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid
PubChem CID45496333
Molecular FormulaC12H7F2NO3
Molecular Weight251.19 g/mol
Exact Mass251.04
IUPAC Name6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(-c2ccc(F)cc2F)[nH]c1=O
InChIInChI=1S/C12H7F2NO3/c13-6-1-2-7(9(14)5-6)10-4-3-8(12(17)18)11(16)15-10/h1-5H,(H,15,16)(H,17,18)
InChIKeyYZZSXQYEQFSNHH-UHFFFAOYSA-N
XLogP2.02
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.19
LogP ≤ 52.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid?
The IUPAC name of 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid (CID 45496333) is 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid?
The canonical SMILES for 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid is O=C(O)c1ccc(-c2ccc(F)cc2F)[nH]c1=O.
What is the InChIKey of 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid?
The InChIKey is YZZSXQYEQFSNHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F2NO3/c13-6-1-2-7(9(14)5-6)10-4-3-8(12(17)18)11(16)15-10/h1-5H,(H,15,16)(H,17,18).
What are the key properties of 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid?
6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid has a molecular weight of 251.19 g/mol, XLogP of 2.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid is sourced from PubChem (CID 45496333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).