About 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine
5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine (PubChem CID 45496777) has the molecular formula C13H15FN4S
and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine |
| PubChem CID | 45496777 |
| Molecular Formula | C13H15FN4S |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine |
| SMILES | Fc1ccc(C2=NN=C(N3CCNCC3)SC2)cc1 |
| InChI | InChI=1S/C13H15FN4S/c14-11-3-1-10(2-4-11)12-9-19-13(17-16-12)18-7-5-15-6-8-18/h1-4,15H,5-9H2 |
| InChIKey | QWMYLLLDOYLDHC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine?
The IUPAC name of 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine (CID 45496777) is 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine.
What is the SMILES notation for 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine?
The canonical SMILES for 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine is Fc1ccc(C2=NN=C(N3CCNCC3)SC2)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine?
The InChIKey is QWMYLLLDOYLDHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN4S/c14-11-3-1-10(2-4-11)12-9-19-13(17-16-12)18-7-5-15-6-8-18/h1-4,15H,5-9H2.
What are the key properties of 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine?
5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine has a molecular weight of 278.36 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-2-piperazin-1-yl-6H-1,3,4-thiadiazine is sourced from PubChem (CID 45496777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).