C11H7ClN2O — CID 45496834
2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]acetonitrile (PubChem CID 45496834) has the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]acetonitrile.
| Compound Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]acetonitrile |
|---|---|
| PubChem CID | 45496834 |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]acetonitrile |
| SMILES | N#CCc1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C11H7ClN2O/c12-9-3-1-8(2-4-9)11-7-10(5-6-13)14-15-11/h1-4,7H,5H2 |
| InChIKey | OCYYBECMRCHNOE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |