C13H22F3N3O — CID 45497352
N-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide (PubChem CID 45497352) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 45497352 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3N3O/c14-13(15,16)10-18-6-8-19(9-7-18)12(20)17-11-4-2-1-3-5-11/h11H,1-10H2,(H,17,20) |
| InChIKey | JIXDTXRFHHLJPB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |