C43H37N6O5S2+ — CID 4549743
3-[2-[3-[5-(1,3-benzothiazol-2-yloxy)-1-ethyl-3-methylbenzimidazol-2-ylidene]prop-1-enyl]-6-(1,3-benzoxazol-2-yl)-3-phenylbenzimidazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 4549743) has the molecular formula C43H37N6O5S2+ and a molecular weight of 781.94 g/mol. Its IUPAC name is 3-[2-[3-[5-(1,3-benzothiazol-2-yloxy)-1-ethyl-3-methylbenzimidazol-2-ylidene]prop-1-enyl]-6-(1,3-benzoxazol-2-yl)-3-phenylbenzimidazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[3-[5-(1,3-benzothiazol-2-yloxy)-1-ethyl-3-methylbenzimidazol-2-ylidene]prop-1-enyl]-6-(1,3-benzoxazol-2-yl)-3-phenylbenzimidazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 4549743 |
| Molecular Formula | C43H37N6O5S2+ |
| Molecular Weight | 781.94 g/mol |
| Exact Mass | 781.23 |
| IUPAC Name | 3-[2-[3-[5-(1,3-benzothiazol-2-yloxy)-1-ethyl-3-methylbenzimidazol-2-ylidene]prop-1-enyl]-6-(1,3-benzoxazol-2-yl)-3-phenylbenzimidazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCN1C(=CC=Cc2n(-c3ccccc3)c3ccc(-c4nc5ccccc5o4)cc3[n+]2CCCS(=O)(=O)O)N(C)c2cc(Oc3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C43H36N6O5S2/c1-3-47-34-24-22-31(53-43-45-33-16-8-10-18-39(33)55-43)28-36(34)46(2)40(47)19-11-20-41-48(25-12-26-56(50,51)52)37-27-29(42-44-32-15-7-9-17-38(32)54-42)21-23-35(37)49(41)30-13-5-4-6-14-30/h4-11,13-24,27-28H,3,12,25-26H2,1-2H3/p+1 |
| InChIKey | AAUKRRWSBPSQDE-UHFFFAOYSA-O |
| XLogP | 9.24 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.94 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|