About [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate
[5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate (PubChem CID 45497882) has the molecular formula C22H19N3O4
and a molecular weight of 389.41 g/mol. Its IUPAC name is [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate.
Molecular Properties
| Compound Name | [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate |
| PubChem CID | 45497882 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate |
| SMILES | CC1Cc2cc(-c3cc(COC(=O)Cn4cnc5ccccc54)no3)ccc2O1 |
| InChI | InChI=1S/C22H19N3O4/c1-14-8-16-9-15(6-7-20(16)28-14)21-10-17(24-29-21)12-27-22(26)11-25-13-23-18-4-2-3-5-19(18)25/h2-7,9-10,13-14H,8,11-12H2,1H3 |
| InChIKey | OOGFDWSDVHPNOQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate?
The IUPAC name of [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate (CID 45497882) is [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate.
What is the SMILES notation for [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate?
The canonical SMILES for [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate is CC1Cc2cc(-c3cc(COC(=O)Cn4cnc5ccccc54)no3)ccc2O1.
What is the InChIKey of [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate?
The InChIKey is OOGFDWSDVHPNOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O4/c1-14-8-16-9-15(6-7-20(16)28-14)21-10-17(24-29-21)12-27-22(26)11-25-13-23-18-4-2-3-5-19(18)25/h2-7,9-10,13-14H,8,11-12H2,1H3.
What are the key properties of [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate?
[5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate has a molecular weight of 389.41 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]methyl 2-(benzimidazol-1-yl)acetate is sourced from PubChem (CID 45497882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).