About [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate
[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 45497894) has the molecular formula C21H16FN3O4
and a molecular weight of 393.37 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate |
| PubChem CID | 45497894 |
| Molecular Formula | C21H16FN3O4 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | COc1ccc(-c2cc(COC(=O)c3cc(-c4ccc(F)cc4)n[nH]3)no2)cc1 |
| InChI | InChI=1S/C21H16FN3O4/c1-27-17-8-4-14(5-9-17)20-10-16(25-29-20)12-28-21(26)19-11-18(23-24-19)13-2-6-15(22)7-3-13/h2-11H,12H2,1H3,(H,23,24) |
| InChIKey | XVMVZGLKPUBCHB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
The IUPAC name of [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate (CID 45497894) is [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate.
What is the SMILES notation for [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
The canonical SMILES for [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate is COc1ccc(-c2cc(COC(=O)c3cc(-c4ccc(F)cc4)n[nH]3)no2)cc1.
What is the InChIKey of [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
The InChIKey is XVMVZGLKPUBCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16FN3O4/c1-27-17-8-4-14(5-9-17)20-10-16(25-29-20)12-28-21(26)19-11-18(23-24-19)13-2-6-15(22)7-3-13/h2-11H,12H2,1H3,(H,23,24).
What are the key properties of [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate has a molecular weight of 393.37 g/mol, XLogP of 4.24, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 45497894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).