C25H29FN6O2S — CID 45498750
12-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-8-pentyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 45498750) has the molecular formula C25H29FN6O2S and a molecular weight of 496.61 g/mol. Its IUPAC name is 12-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-8-pentyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-8-pentyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 45498750 |
| Molecular Formula | C25H29FN6O2S |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 12-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-8-pentyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | CCCCCn1c(=O)c2sccc2n2c(CCC(=O)N3CCN(c4ccccc4F)CC3)nnc12 |
| InChI | InChI=1S/C25H29FN6O2S/c1-2-3-6-12-31-24(34)23-20(11-17-35-23)32-21(27-28-25(31)32)9-10-22(33)30-15-13-29(14-16-30)19-8-5-4-7-18(19)26/h4-5,7-8,11,17H,2-3,6,9-10,12-16H2,1H3 |
| InChIKey | RQNJMEMYIZYSMO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|