C26H33N3O2 — CID 4550253
N-cycloheptyl-2-[2-(N-ethylanilino)ethyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 4550253) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-cycloheptyl-2-[2-(N-ethylanilino)ethyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | N-cycloheptyl-2-[2-(N-ethylanilino)ethyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 4550253 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-cycloheptyl-2-[2-(N-ethylanilino)ethyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | CCN(CCN1C(=O)c2ccccc2C1C(=O)NC1CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H33N3O2/c1-2-28(21-14-8-5-9-15-21)18-19-29-24(22-16-10-11-17-23(22)26(29)31)25(30)27-20-12-6-3-4-7-13-20/h5,8-11,14-17,20,24H,2-4,6-7,12-13,18-19H2,1H3,(H,27,30) |
| InChIKey | CNDJMXACUQJVHW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |