C27H30N2O — CID 4550674
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(4-ethylphenyl)quinoline-4-carboxamide (PubChem CID 4550674) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(4-ethylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(4-ethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4550674 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(4-ethylphenyl)quinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)NC(C)C3CC4CCC3C4)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H30N2O/c1-3-18-8-11-20(12-9-18)26-16-24(22-6-4-5-7-25(22)29-26)27(30)28-17(2)23-15-19-10-13-21(23)14-19/h4-9,11-12,16-17,19,21,23H,3,10,13-15H2,1-2H3,(H,28,30) |
| InChIKey | VKXFOSPCAOUWIC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |