About [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol
[3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol (PubChem CID 4550710) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol |
| PubChem CID | 4550710 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol |
| SMILES | CC12CC3(C)CC(CO)(C1)CC(CO)(C2)C3 |
| InChI | InChI=1S/C14H24O2/c1-11-3-12(2)6-13(4-11,9-15)8-14(5-11,7-12)10-16/h15-16H,3-10H2,1-2H3 |
| InChIKey | QTEXCNQLVLUGAN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol?
The IUPAC name of [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol (CID 4550710) is [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol is CC12CC3(C)CC(CO)(C1)CC(CO)(C2)C3.
What is the InChIKey of [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol?
The InChIKey is QTEXCNQLVLUGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-11-3-12(2)6-13(4-11,9-15)8-14(5-11,7-12)10-16/h15-16H,3-10H2,1-2H3.
What are the key properties of [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol?
[3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol has a molecular weight of 224.34 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-5,7-dimethyl-1-adamantyl]methanol is sourced from PubChem (CID 4550710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).