About 3-chloro-N-(2,6-dimethylphenyl)propanamide
3-chloro-N-(2,6-dimethylphenyl)propanamide (PubChem CID 4550832) has the molecular formula C11H14ClNO
and a molecular weight of 211.69 g/mol. Its IUPAC name is 3-chloro-N-(2,6-dimethylphenyl)propanamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,6-dimethylphenyl)propanamide |
| PubChem CID | 4550832 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-chloro-N-(2,6-dimethylphenyl)propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCl |
| InChI | InChI=1S/C11H14ClNO/c1-8-4-3-5-9(2)11(8)13-10(14)6-7-12/h3-5H,6-7H2,1-2H3,(H,13,14) |
| InChIKey | VOTVVKNPQNCBKS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,6-dimethylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,6-dimethylphenyl)propanamide?
The IUPAC name of 3-chloro-N-(2,6-dimethylphenyl)propanamide (CID 4550832) is 3-chloro-N-(2,6-dimethylphenyl)propanamide.
What is the SMILES notation for 3-chloro-N-(2,6-dimethylphenyl)propanamide?
The canonical SMILES for 3-chloro-N-(2,6-dimethylphenyl)propanamide is Cc1cccc(C)c1NC(=O)CCCl.
What is the InChIKey of 3-chloro-N-(2,6-dimethylphenyl)propanamide?
The InChIKey is VOTVVKNPQNCBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO/c1-8-4-3-5-9(2)11(8)13-10(14)6-7-12/h3-5H,6-7H2,1-2H3,(H,13,14).
What are the key properties of 3-chloro-N-(2,6-dimethylphenyl)propanamide?
3-chloro-N-(2,6-dimethylphenyl)propanamide has a molecular weight of 211.69 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,6-dimethylphenyl)propanamide is sourced from PubChem (CID 4550832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).