About nickel;bis(nitric acid)
nickel;bis(nitric acid) (PubChem CID 4551326) has the molecular formula H2N2NiO6
and a molecular weight of 184.72 g/mol. Its IUPAC name is nickel;bis(nitric acid).
Molecular Properties
| Compound Name | nickel;bis(nitric acid) |
| PubChem CID | 4551326 |
| Molecular Formula | H2N2NiO6 |
| Molecular Weight | 184.72 g/mol |
| Exact Mass | 183.93 |
| IUPAC Name | nickel;bis(nitric acid) |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])O.[Ni] |
| InChI | InChI=1S/2HNO3.Ni/c2*2-1(3)4;/h2*(H,2,3,4); |
| InChIKey | AVSAROLCPPRWLC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.72 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nickel;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;bis(nitric acid)?
The IUPAC name of nickel;bis(nitric acid) (CID 4551326) is nickel;bis(nitric acid).
What is the SMILES notation for nickel;bis(nitric acid)?
The canonical SMILES for nickel;bis(nitric acid) is O=[N+]([O-])O.O=[N+]([O-])O.[Ni].
What is the InChIKey of nickel;bis(nitric acid)?
The InChIKey is AVSAROLCPPRWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/2HNO3.Ni/c2*2-1(3)4;/h2*(H,2,3,4);.
What are the key properties of nickel;bis(nitric acid)?
nickel;bis(nitric acid) has a molecular weight of 184.72 g/mol, XLogP of -0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;bis(nitric acid) is sourced from PubChem (CID 4551326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).