C23H20F4N2O4S — CID 4551871
2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 4551871) has the molecular formula C23H20F4N2O4S and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4551871 |
| Molecular Formula | C23H20F4N2O4S |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C(F)(F)F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H20F4N2O4S/c1-2-33-20-11-13-21(14-12-20)34(31,32)29(19-9-5-17(24)6-10-19)15-22(30)28-18-7-3-16(4-8-18)23(25,26)27/h3-14H,2,15H2,1H3,(H,28,30) |
| InChIKey | RCAHHLJPUMAVQQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |