C19H13FN6 — CID 4552845
10-benzyl-4-(3-fluorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4552845) has the molecular formula C19H13FN6 and a molecular weight of 344.35 g/mol. Its IUPAC name is 10-benzyl-4-(3-fluorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-benzyl-4-(3-fluorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4552845 |
| Molecular Formula | C19H13FN6 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 10-benzyl-4-(3-fluorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Fc1cccc(-c2nc3c4cnn(Cc5ccccc5)c4ncn3n2)c1 |
| InChI | InChI=1S/C19H13FN6/c20-15-8-4-7-14(9-15)17-23-19-16-10-22-25(11-13-5-2-1-3-6-13)18(16)21-12-26(19)24-17/h1-10,12H,11H2 |
| InChIKey | OTVWAADFWHBVMX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |